| ImmunCR Id : | ICR98 |
| Chemical Name : | Shogoal |
| Plant Source : | Zingiber officinale Roscoe |
| Nutraceutical information : | Edible, Ginger |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | Anti-cancer (upregulates ROS, activates caspase-3,-7, GADD 153 expression, regulates AKT/mtor pathway, PERK dephosphorylation, PARP degradation, downregulates MMP-9, G2/M cell cycle arrest); Nephroprotective (reduced BUN, creatinine, upregulates gshpx); Neuroprotective (upregulates HIF-1α, HO-1, regulates PI3K/Akt/mtor signaling pathway) |
| Description : | Shogoal is extracted from ginger and forms through drying and thermal processing of gingerol. It is a phenolic compound having a pale-yellow and crystalline appearance, with [6]-shogoal as the most abundant analogue. |
| IUPAC Name | (E)-1-(3-methoxy-4-trimethylsilyloxyphenyl)dec-4-en-3-one |
| SMILES | CCCCCC=CC(=O)CCC1=CC(=C(C=C1)O[Si](C)(C)C)OC |
| Formula | C20H32O3Si |
| InchiKey | NMBUJLNQCJYCNL-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Anisoles |
| LogP | 6.666 |
| Molecular weight | 348.552 |
| Hydrogen Bond Acceptor | 3 |
| Hydrogen Bond Donor | 0 |
| Polar surface area | 35.16 |
| No. of rotatable bonds | 11 |
| Number of Aromatic Rings | 1 |
| Number of rings | 1 |
| Absorption level | Moderate |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Very High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Inhibitor |
