| ImmunCR Id : | ICR97 |
| Chemical Name : | Gingerol |
| Plant Source : | Zingiber officinale Roscoe |
| Nutraceutical information : | Edible, Ginger |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | Anti-cancer (inhibits NF-kb, VEGF, AP-1, COX-2, MAPK, EGF, MMP, inos, regulates JNK, IKK, Akt, P13K, CDK (1,2,4,6,7), Bcl-2, cyclin D1, upregulates ROS, Apaf-1 (protease-activating factor-1), caspase (3,7,8,9), Bcl-XL, p53); Anti-Alzheimer (downregulates COX-2, Aβ-42, APH1a, β-secretase); Anti-inflammatory (inhibits IL-6, IL-1β, NO, TNF-α, downregulates COX-2, inos) |
| Description : | Gingerol is a phenolic compound containing beta hydroxy group, found largely in fresh ginger other plants of Zingiberaceae family. [6]-Gingerol being the biggest component followed by other [4], [8], [10], [12] analogues. |
| IUPAC Name | (5S)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)decan-3-one |
| SMILES | CCCCCC(CC(=O)CCC1=CC(=C(C=C1)O)OC)O |
| Formula | C17H26O4 |
| InchiKey | NLDDIKRKFXEWBK-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Phenols |
| Subclass | Methoxyphenols |
| LogP | 3.638 |
| Molecular weight | 294.386 |
| Hydrogen Bond Acceptor | 4 |
| Hydrogen Bond Donor | 2 |
| Polar surface area | 67.861 |
| No. of rotatable bonds | 10 |
| Number of Aromatic Rings | 1 |
| Number of rings | 1 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Medium |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
