| ImmunCR Id : | ICR95 |
| Chemical Name : | Eugenol acetate |
| Plant Source : | Syzygium aromaticum |
| Nutraceutical information : | Edible, Clove |
| Mode of administration : | Oil |
| Immunomodulatory mechanism : | Anti-bacterial (ROS scavenging, active against Gram positive bacteria and E.coli, L. Monocitogenes); Anti-fungal (inhibits mycelial growth); Antioxidant (free radical scavenging); inhibits acetylcholinestrase, β-glucuronidase; inhibits melanin formation to treat hyperpigmentation; Anti-ulcer |
| Description : | Eugenol acetate is a bioactive biochemical and is formed via shikimic acid pathway. It is not It is more stable because of presence of acetate group and less hydrophilic than euganol. |
| IUPAC Name | (2-methoxy-4-prop-2-enylphenyl) acetate |
| SMILES | CC(=O)OC1=C(C=C(C=C1)CC=C)OC |
| Formula | C12H14O3 |
| InchiKey | SCCDQYPEOIRVGX-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Phenol esters |
| Subclass | --- |
| LogP | 2.589 |
| Molecular weight | 206.238 |
| Hydrogen Bond Acceptor | 3 |
| Hydrogen Bond Donor | 0 |
| Polar surface area | 35.16 |
| No. of rotatable bonds | 5 |
| Number of Aromatic Rings | 1 |
| Number of rings | 1 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | High |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
