| ImmunCR Id : | ICR93 |
| Chemical Name : | Fucoidan |
| Plant Source : | Lithospermum erythrorhizon |
| Nutraceutical information : | Brown marine algae, Dictyota menstrualis, Fucus distichus, etc. |
| Mode of administration : | Intravenous, intramuscular, intraperitoneal |
| Immunomodulatory mechanism : | Anti-cancer (G0/G1 phase arrest, caspase 8/9); Anti-Hepatitic B virus (upregulates TNF-α, IL-2, IFN-g, downregulated HBV replication maybe because of activation of MAPK-ERK1/2 pathway); Anti-HIV (possibly exhibit anti HIV activity at 1.56, 6.25 μg/ml concentrations); Anti-diabetic (inhibits α-glucosidase, VEGF signaling, regulates AMPK signaling, GLUT activity); Anti-cogulant; Used in traditional Chinese medicine to cure goitre, edema, boils; Anti-Alzheimer (inhibit ROS production) |
| Description : | Fucoidan is a sulfated L-fucose carbohydrate, soluble in both water and acid solutions. It is a hygroscopic polysachharide and negatively charged. It was first extracted from a brown marine algae in 1913. |
| IUPAC Name | [(2S,3S,4S,5S,6R)-4-hydroxy-5-methoxy-2,6-dimethyloxan-3-yl] hydrogen sulfate |
| SMILES | CC1C(C(C(C(O1)C)OS(=O)(=O)O)O)OC |
| Formula | C8H16O7S |
| InchiKey | WZPKXSSMRAQGAC-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Oxanes |
| Subclass | --- |
| LogP | -0.71 |
| Molecular weight | 256.273 |
| Hydrogen Bond Acceptor | 7 |
| Hydrogen Bond Donor | 2 |
| Polar surface area | 103.022 |
| No. of rotatable bonds | 3 |
| Number of Aromatic Rings | 0 |
| Number of rings | 1 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
