| ImmunCR Id : | ICR88 |
| Chemical Name : | Gamma-glutamylcysteine |
| Plant Source : | Allium species |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | --- |
| Description : | It is a precursor for glutathione. |
| IUPAC Name | (2S)-2-amino-5-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-5-oxopentanoic acid |
| SMILES | C(CC(=O)NC(CS)C(=O)O)C(C(=O)O)N |
| Formula | C8H14N2O5S |
| InchiKey | RITKHVBHSGLULN-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| LogP | -3.832 |
| Molecular weight | 250.272 |
| Hydrogen Bond Acceptor | 7 |
| Hydrogen Bond Donor | 5 |
| Polar surface area | 132.883 |
| No. of rotatable bonds | 7 |
| Number of Aromatic Rings | 0 |
| Number of rings | 0 |
| Absorption level | low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
