| ImmunCR Id : | ICR85 |
| Chemical Name : | Betulinic acid |
| Plant Source : | Betulinic acid |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Anti-tumor (releases Smac, cytochrome c); Anti-inflammatory (inhibits TNF-α, NO, NF-κb, TGF-b1, inos, ERK phosphorylation, Akt phosphorylation, increases IL-10, downregulates ICAM-1, MCP-1, MMP-9, suppresses COX-2, PEG2, ROS); Anti-diabetic (regulates CAMKK-AMPK-CREB signaling pathway, activates AMPK, inhibits CREB (camp response element-binding protein) phosphorylated expression, ICAM, ET-1, downregulates enos (endothelial nitric oxide synthase), IL-1β, IL-6, TNF-α) |
| Description : | Betulinic acid, 3-beta-hydroxy-lup20(29)-en-28-oic acid is a pentacyclic triterpenoid found in the plant kingdom. |
| IUPAC Name | (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
| SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)C(=O)O |
| Formula | C30H48O3 |
| InchiKey | QGJZLNKBHJESQX-FZFNOLFKSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Triterpenoids |
| LogP | 6.546 |
| Molecular weight | 456.7 |
| Hydrogen Bond Acceptor | 3 |
| Hydrogen Bond Donor | 2 |
| Polar surface area | 58.931 |
| No. of rotatable bonds | 2 |
| Number of Aromatic Rings | 0 |
| Number of rings | 5 |
| Absorption level | low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
