| ImmunCR Id : | ICR82 |
| Chemical Name : | Ferruginol |
| Plant Source : | Araucaria araucana |
| Nutraceutical information : | --- |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | Gastroprotective (increased PGE2 (prostaglandin E2); Anti-cancer (G2/M phase cycle arrest, upregulates p38 phosphorylation, nuclear translocation of NF-κb, activates caspase-3) |
| Description : | Ferruginol is found in the family of Podocarpaceae, Cupressaceae, Lamiaceae, Verbenaceae. It is an abietane diterpenoid. |
| IUPAC Name | (4bS,8aS)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol |
| SMILES | CC(C)C1=C(C=C2C(=C1)CCC3C2(CCCC3(C)C)C)O |
| Formula | C20H30O |
| InchiKey | QXNWVJOHUAQHLM-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Diterpenoids |
| LogP | 6.004 |
| Molecular weight | 286.452 |
| Hydrogen Bond Acceptor | 1 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 20.815 |
| No. of rotatable bonds | 1 |
| Number of Aromatic Rings | 1 |
| Number of rings | 3 |
| Absorption level | Moderate |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Very High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
