| ImmunCR Id : | ICR81 |
| Chemical Name : | 6,7-Dehydroroyleanone |
| Plant Source : | Cryptomeria japonica |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Anti-cancer (activates caspase-3,-9); Acts against Leishmania, Mycobacterium tuberculosis. |
| Description : | DHR has an orange-red color and is a quinone diterpene with an abietane structure. |
| IUPAC Name | (4bS,8aS)-1-hydroxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthrene-3,4-dione |
| SMILES | CC(C)C1=C(C2=C(C(=O)C1=O)C3(CCCC(C3C=C2)(C)C)C)O |
| Formula | C20H26O3 |
| InchiKey | DLSQHYBGHVPMAE-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Diterpenoids |
| LogP | 4.002 |
| Molecular weight | 314.419 |
| Hydrogen Bond Acceptor | 3 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 55.417 |
| No. of rotatable bonds | 1 |
| Number of Aromatic Rings | 0 |
| Number of rings | 3 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
