| ImmunCR Id : | ICR80 |
| Chemical Name : | 6-Hydroxy-5,6-dehydrosugiol (HDHS) |
| Plant Source : | Cryptomeria japonica |
| Nutraceutical information : | --- |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | Anti-cancer (G0/G1 phase cycle arrest, activates caspase-3,-7, cleaves PARP (poly (ADP-ribose) polymerase), reduces Bcl-xl, cyclin D1, E, CDK2,4,6, increases p53, p21, p27) |
| Description : | HDHS is an abietane diphenolic compount, acts as an adrogen receptor antagonist. It is a derivative of Suigol. |
| IUPAC Name | 6,10-dihydroxy-1,1,4a-trimethyl-7-propan-2-yl-3,4-dihydro-2H-phenanthren-9-one |
| SMILES | CC(C)C1=C(C=C2C(=C1)C(=O)C(=C3C2(CCCC3(C)C)C)O)O |
| Formula | C20H26O3 |
| InchiKey | XLUHSPYVUOVWRM-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Diterpenoids |
| LogP | 4.645 |
| Molecular weight | 314.419 |
| Hydrogen Bond Acceptor | 3 |
| Hydrogen Bond Donor | 2 |
| Polar surface area | 58.931 |
| No. of rotatable bonds | 1 |
| Number of Aromatic Rings | 1 |
| Number of rings | 3 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
