| ImmunCR Id : | ICR79 |
| Chemical Name : | Carnosol |
| Plant Source : | Rosmarinus officinalis |
| Nutraceutical information : | Rosmarinus officinalis, Salvia officinalis |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Antioxidant (ROS scavenger, inhibits lipid peroxidation, downregulates cytochrome c, activates Nrf2, upregulates GSH, HO-1 (heme oxygenase), GST (glutathione-S-transferase), NAD(P)H-quinone reductase, suppressed nuclear translocation of NF-κb); Anti-cancer (downregulates CYP1A1 mrna expression, cyclin-D1,D2,D3, COX-2, PEG2 mrna, p21, Bcl-2, P13K, inhibits activation of PKC (protein kinase C), ERK1/2, JNK, p38, increases gstπ protein and mrna, G2 phase cycle arrest, PTEN (pro-apoptotic phosphatase and tensin), QR mrna expression, 4EBP1 (eukaryotic translation initiation factor 4E-binding protein 1), caspase-3,-9, PARP, p53, Bax, inhibit phosphorylation of STAT3, Jak2, Src); Anti-inflammatory (inhibits Caspase-1, NLRP3, IL-1β, NLRC4) |
| Description : | Carnosol is a natural ortho-diphenolic diterpene, formed by oxidative degradation of carnosic acid. It is part of the abietane group, it has two hydroxyl groups at C-11, C-12 possessing a lactone moiety across the B ring. |
| IUPAC Name | (4aR,10aS)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid |
| SMILES | CC(C)C1=C(C(=C2C(=C1)C3CC4C2(CCCC4(C)C)C(=O)O3)O)O |
| Formula | C20H26O4 |
| InchiKey | XUSYGBPHQBWGAD-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Terpene lactones |
| LogP | 4.387 |
| Molecular weight | 330.418 |
| Hydrogen Bond Acceptor | 4 |
| Hydrogen Bond Donor | 2 |
| Polar surface area | 67.861 |
| No. of rotatable bonds | 1 |
| Number of Aromatic Rings | 1 |
| Number of rings | 4 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
