| ImmunCR Id : | ICR78 |
| Chemical Name : | Carnosic acid |
| Plant Source : | Rosmarinus officinalis |
| Nutraceutical information : | Rosmarinus officinalis, Salvia officinalis |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Antioxidant (ROS (reactive oxygen species) scavenger, downregulate hydroperoxide formation in fatty acids); Antimicrobial (active against Gram negative and Gram positive bacteria); Anti-inflammatory (inhibits NF-κb, upregulates HO-1, NRF2 expression, downregulates TNF-α, NO); Neuroprotective (downregulate IL-1β, IL-6, NO (nitric oxide), inhibits NLRP3 activation, activates KEAP1/NRF2 pathway) |
| Description : | Carnosic acid has a lipophilic structure and is a phenolic diterpene containing a single phenol group, also contains two hydroxyl groups at ortho positions C11, C12, first extracted from Salvia officinalis with more abundance of trichome along with it in the leaves. The hot and harsh enviornmental factors affect the carnosic acid levels in the plant leaves. |
| IUPAC Name | (4aR,10aS)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid |
| SMILES | CC(C)C1=C(C(=C2C(=C1)CC[C@@H]3[C@@]2(CCCC3(C)C)C(=O)O)O)O |
| Formula | C20H28O4 |
| InchiKey | QRYRORQUOLYVBU-VBKZILBWSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Diterpenoids |
| LogP | 4.905 |
| Molecular weight | 332.434 |
| Hydrogen Bond Acceptor | 4 |
| Hydrogen Bond Donor | 3 |
| Polar surface area | 79.747 |
| No. of rotatable bonds | 2 |
| Number of Aromatic Rings | 1 |
| Number of rings | 3 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
