| ImmunCR Id : | ICR71 |
| Chemical Name : | Wilforlide A |
| Plant Source : | Triptrtygium Wilford II |
| Nutraceutical information : | --- |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | Anti-arthritic (inhibits inos, MCP1, M-CSF, GM-CSF, TLR4/NF-κb signaling pathway, phosphorylation of p65, upregulates CD68, downregulates IL-10, tgfβ, iκbα) |
| Description : | Extracts from the root of Tripterygium wilfordii has been used in traditional Chinese medicine for over 2000 years for treating different diseases. Wilfordii A has been naturally used as an anti-inflammatory especially for treating RA (rheumatoid arthritis) |
| IUPAC Name | (1S,2R,5S,6R,9R,11S,14R,15R,19S,21S)-11-hydroxy-2,5,6,10,10,14,21-heptamethyl-23-oxahexacyclo[19.2.1.02,19.05,18.06,15.09,14]tetracos-17-en-22-one |
| SMILES | CC1(C2CCC3(C(C2(CCC1O)C)CC=C4C3(CCC5(C4CC6(CC5OC6=O)C)C)C)C)C |
| Formula | C30H46O3 |
| InchiKey | HHQJBWYXBWOFJY-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Triterpenoids |
| LogP | 5.928 |
| Molecular weight | 454.684 |
| Hydrogen Bond Acceptor | 3 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 47.046 |
| No. of rotatable bonds | 0 |
| Number of Aromatic Rings | 0 |
| Number of rings | 6 |
| Absorption level | Moderate |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Very High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
