| ImmunCR Id : | ICR7 |
| Chemical Name : | Papaverine |
| Plant Source : | Opium alkaloid |
| Nutraceutical information : | --- |
| Mode of administration : | Capsule, Injection, cream |
| Immunomodulatory mechanism : | Camp-specific 3',5'-cyclic phosphodiesterase 4B, camp and camp-inhibited cgmp 3',5'-cyclic phosphodiesterase 10A, Phosphodiesterase enzymes causing an elevation of cyclic AMP levels.(INHIBITOR IN HUMANS) |
| Description : | Papaverine is a benzylisoquinoline alkaloid that has a 3,4-dimethoxybenzyl group at position 1 and methoxy groups at positions 6 and 7. The main source is Papaver somniferum. |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline |
| SMILES | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC |
| Formula | C20H21NO4 |
| InchiKey | XQYZDYMELSJDRZ-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Isoquinolines and derivatives |
| Subclass | Benzylisoquinolines |
| LogP | 3.503 |
| Molecular weight | 339.385 |
| Hydrogen Bond Acceptor | 5 |
| Hydrogen Bond Donor | 0 |
| Polar surface area | 46.981 |
| No. of rotatable bonds | 6 |
| Number of Aromatic Rings | 3 |
| Number of rings | 3 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | High |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
