| ImmunCR Id : | ICR69 |
| Chemical Name : | Artesunate |
| Plant Source : | Artemisia annua L |
| Nutraceutical information : | --- |
| Mode of administration : | Intravenous, Oral |
| Immunomodulatory mechanism : | Anti-inflammatory (downregulates IL-6, tnfα, COX-2, NF-κb, inos, activates Nrf2, upregulates HO-1); Anti-asthma (increase NO, reduced cyclin B1, cdc2 mrna, G2 phase cycle arrest); Anti-cancer (downregulates cyclin D, CDK4, p-Rb, upregulates sub G1, p21, p-mtor) |
| Description : | Artesunate is a second generation sesquiterpene with high water solubility and formed by reacting DHA with succinic acid anhydride. |
| IUPAC Name | 4-oxo-4-[[(1R,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butanoic acid |
| SMILES | C[C@@H]1CC[C@H]2[C@H]([C@@H](O[C@H]3[C@@]24[C@H]1CC[C@](O3)(OO4)C)OC(=O)CCC(=O)O)C |
| Formula | C19H28O8 |
| InchiKey | FIHJKUPKCHIPAT-AHIGJZGOSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Sesquiterpenoids |
| LogP | 1.845 |
| Molecular weight | 384.421 |
| Hydrogen Bond Acceptor | 8 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 100.067 |
| No. of rotatable bonds | 5 |
| Number of Aromatic Rings | 0 |
| Number of rings | 4 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Low |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
