| ImmunCR Id : | ICR68 |
| Chemical Name : | Arteether |
| Plant Source : | Artemisia annua L |
| Nutraceutical information : | --- |
| Mode of administration : | Oral, intramuscular |
| Immunomodulatory mechanism : | Antimalaria |
| Description : | Arteether is a second generation oil soluble artemisinin and an ethyl derivative of DHA. |
| IUPAC Name | (1R,4S,5R,8S,9R,10S,12R,13R)-10-ethoxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | CCO[C@@H]1[C@@H]([C@@H]2CC[C@H]([C@H]3[C@]24[C@H](O1)O[C@@](CC3)(OO4)C)C)C |
| Formula | C17H28O5 |
| InchiKey | NLYNIRQVMRLPIQ-XQLAAWPRSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Sesquiterpenoids |
| LogP | 2.378 |
| Molecular weight | 312.401 |
| Hydrogen Bond Acceptor | 5 |
| Hydrogen Bond Donor | 0 |
| Polar surface area | 44.65 |
| No. of rotatable bonds | 2 |
| Number of Aromatic Rings | 0 |
| Number of rings | 4 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | High |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
