| ImmunCR Id : | ICR67 |
| Chemical Name : | Artemether |
| Plant Source : | Artemisia annua L |
| Nutraceutical information : | --- |
| Mode of administration : | Oral, intramuscular |
| Immunomodulatory mechanism : | Neuroprotective (upregulates phosphorylation of AMPK/GSK3β(ser9) pathway, decreases amyloid-β, Tau phosphorylation, GFAP (Glial fibrillary acidic protein), Bax, MDA (malonaldehyde), increases Bcl-2, SOD (superoxide dismutase), upregulates Nrf2/HO-1 (heme oxygenase-1) signaling pathway); Anti-inflammatory (decreases IL-18, NF-κb); Hepatoprotective (reduced GSH, GST |
| Description : | Artemether is a lipid soluble methyl ether sesquiterpene derivative of dihydriartemisinin (DHA), possessing the ability to cross blood brain barrier and first used against fever and malaria. |
| IUPAC Name | (1R,4S,5R,8S,9R,10S,12R,13R)-10-methoxy-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | CCOC1C(C2CCC(C3C24C(O1)OC(CC3)(OO4)C)C)C |
| Formula | C17H28O5 |
| InchiKey | NLYNIRQVMRLPIQ-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Sesquiterpenoids |
| LogP | 2.378 |
| Molecular weight | 312.401 |
| Hydrogen Bond Acceptor | 5 |
| Hydrogen Bond Donor | 0 |
| Polar surface area | 44.65 |
| No. of rotatable bonds | 2 |
| Number of Aromatic Rings | 0 |
| Number of rings | 4 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | High |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
