| ImmunCR Id : | ICR63 |
| Chemical Name : | Batatasin I |
| Plant Source : | Dioscorea batata |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | --- |
| Description : | --- |
| IUPAC Name | 2,5,7-trimethoxyphenanthren-3-ol |
| SMILES | COC1=CC(=C2C(=C1)C=CC3=CC(=C(C=C32)O)OC)OC |
| Formula | C17H16O4 |
| InchiKey | KGYHMWVRKYFQQR-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Benzenoids |
| Class | Phenanthrenes and derivatives |
| Subclass | Phenanthrols |
| LogP | 3.355 |
| Molecular weight | 284.307 |
| Hydrogen Bond Acceptor | 4 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 47.605 |
| No. of rotatable bonds | 3 |
| Number of Aromatic Rings | 3 |
| Number of rings | 3 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Inhibitor |
