| ImmunCR Id : | ICR61 |
| Chemical Name : | Dodeca-2Z,4E-dien-8,10-diynoic acid isobutylamide |
| Plant Source : | Echinacea purpurea. |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Anti-inflammatory (inhibits COX-1 and COX-2) |
| Description : | It is an alkamide extracted from the roots of Echinacea purpurea |
| IUPAC Name | --- |
| SMILES | CC(C)CNC(=O)\C=C\C=C/CCC#CC#CC |
| Formula | C16H21NO |
| InchiKey | FOAKNWSNLWCNHO-JPYSRSMKSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty amides |
| LogP | 4.226 |
| Molecular weight | 243.344 |
| Hydrogen Bond Acceptor | 1 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 30.111 |
| No. of rotatable bonds | 8 |
| Number of Aromatic Rings | 0 |
| Number of rings | 0 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
