| ImmunCR Id : | ICR60 |
| Chemical Name : | Undeca-2Z,4E-dien-8,10-diynoic acid isobutylamide |
| Plant Source : | Echinacea purpurea. |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Anti-inflammatory: Inhibits COX-1, COX-2 activity |
| Description : | It is an alkamide extracted from the roots of Echinacea purpurea and formerly used as a mosquitocide. |
| IUPAC Name | (2E,4Z)-N-(2-methylpropyl)undeca-2,4-dien-8,10-diynamide |
| SMILES | CC(C)CNC(=O)/C=C\C=C\CC#CC#C |
| Formula | C14H17NO |
| InchiKey | OVMFTYYJXMDIDM-OCBXPSTGSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty amides |
| LogP | 3.82 |
| Molecular weight | 215.291 |
| Hydrogen Bond Acceptor | 1 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 30.111 |
| No. of rotatable bonds | 6 |
| Number of Aromatic Rings | 0 |
| Number of rings | 0 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
