| ImmunCR Id : | ICR58 |
| Chemical Name : | Citrulline |
| Plant Source : | Citrullus lanatus |
| Nutraceutical information : | Edible, Watermelon |
| Mode of administration : | OraL, Liquid, intramuscular injection |
| Immunomodulatory mechanism : | Inhibit JAK2-STAT1 signaling pathway; It has cardioprotective properties by simulating the production of nitric oxide whose levels can be controlled by regulating citrulline administration. Anti-aging (upregulates mtor signaling) |
| Description : | It a water soluble, colorless, non-protein amino acid, the product of a central reaction in urea cycle produced from carbamoyl phosphate and ornithine, can also be synthesized from arginine. The plasma citrulline is a known biomarker for small bowel enterocyte mass. |
| IUPAC Name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid |
| SMILES | C(C[C@@H](C(=O)O)N)CNC(=O)N |
| Formula | C6H13N3O3 |
| InchiKey | RHGKLRLOHDJJDR-BYPYZUCNSA-N |
| Kingdom | Organic compounds |
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| LogP | -3.885 |
| Molecular weight | 175.186 |
| Hydrogen Bond Acceptor | 4 |
| Hydrogen Bond Donor | 4 |
| Polar surface area | 121.307 |
| No. of rotatable bonds | 5 |
| Number of Aromatic Rings | 0 |
| Number of rings | 0 |
| Absorption level | Moderate |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
