| ImmunCR Id : | ICR56 |
| Chemical Name : | Lycopene |
| Plant Source : | Solanum lycopersicum |
| Nutraceutical information : | Edible, Tomato, watermelon, guava, apricot, orange, carrot, mango |
| Mode of administration : | Oral, intravenous, Topical |
| Immunomodulatory mechanism : | Antioxidant (ROS, hydroxyl radicals, hydrogen peroxide, nitrogen dioxide); Cell proliferation (activation of p13k/Akt signalling pathway); Anti-proliferative/Apoptosis (inhibit IGF-1R pathway, blocks PDGF-BB); Anti-cancer (inhibits activates STAT3); Anti-inflammatory (inhibits TNF-α, regulates IL-10); Skin protective (synthesize prostaglandins and phospholipids, inhibit epidermal ornithine decarboxylase to protect against UV radiation) |
| Description : | Lycopene is a natural acyclic unnsaturated carotenoid. It is a non essential dietary nutrient with common use as a food coloring agent. |
| IUPAC Name | (6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene |
| SMILES | CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C)C)C)C)C |
| Formula | C40H56 |
| InchiKey | OAIJSZIZWZSQBC-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Tetraterpenoids |
| LogP | 12.761 |
| Molecular weight | 536.873 |
| Hydrogen Bond Acceptor | 0 |
| Hydrogen Bond Donor | 0 |
| Polar surface area | 0 |
| No. of rotatable bonds | 16 |
| Number of Aromatic Rings | 0 |
| Number of rings | 0 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
