| ImmunCR Id : | ICR49 |
| Chemical Name : | Desmethoxycurcumin |
| Plant Source : | Curcuma longa. |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Anti-cancer (inhibits ERCC1 via P13K-Akt snail pathway), downregulates Thymidine phosphorylase (TP)) |
| Description : | DMC is a metabolite of curcumin having low solubility and bioavailability makes it difficult for clinical uses. |
| IUPAC Name | (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC=C(C=C2)O)O |
| Formula | C20H18O5 |
| InchiKey | HJTVQHVGMGKONQ-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Diarylheptanoids |
| Subclass | Linear diarylheptanoids |
| LogP | 3.57 |
| Molecular weight | 338.354 |
| Hydrogen Bond Acceptor | 5 |
| Hydrogen Bond Donor | 2 |
| Polar surface area | 85.162 |
| No. of rotatable bonds | 7 |
| Number of Aromatic Rings | 2 |
| Number of rings | 2 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Medium |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
