| ImmunCR Id : | ICR48 |
| Chemical Name : | Β-Cryptoxanthin |
| Plant Source : | Actinidia deliciosa |
| Nutraceutical information : | Edible, tangerines, red peppers, and pumpkin |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Anti-obesity (downregulates mrna expression of peroxisome proliferator-activated receptor gamma (pparγ) through retinoic acid receptor (RAR) activation); Anti-inflammatory (supress tnfα, IL-1β, and IL-6, and reduced expression tgfβ1, collagen type Iα1, and plasminogen activator inhibitor-1, ); Anti-cancer (lung Sirtuin 1 (SIRT1), p53, and rarβ reduced expression); Bone Health (express insulin-like growth factor 1 and transforming growth factor β1, transcription factor 2 (Runx2)) |
| Description : | It is a polar oxygenated carotenoid constituting one hydroxyl group at carbon-3 of the β ring with high abundance in serum and tissue having structure similarity to β-carotene, absorbed in the intestine through facilitative transport with assistance from enzyme scavenger receptor class B type 1 (SR-B1). They have high absorbance than other carotenoids. It is also by other names such as (3R)-β, β-caroten-3-ol, 3-hydroxy-β-carotene, physoxanthin, cryptoxanthol, cryptoxanthin, or cryptoxanthene |
| IUPAC Name | (1R)-3,5,5-trimethyl-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-3-en-1-ol |
| SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(CC(CC2(C)C)O)C)C)C |
| Formula | C40H56O |
| InchiKey | DMASLKHVQRHNES-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Tetraterpenoids |
| LogP | 10.761 |
| Molecular weight | 552.872 |
| Hydrogen Bond Acceptor | 1 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 20.815 |
| No. of rotatable bonds | 10 |
| Number of Aromatic Rings | 0 |
| Number of rings | 2 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
