| ImmunCR Id : | ICR47 |
| Chemical Name : | Folate |
| Plant Source : | Actinidia deliciosa |
| Nutraceutical information : | Edible, Spinach, green leafy vegetables |
| Mode of administration : | Oral, Tablets |
| Immunomodulatory mechanism : | Contributes to normal functioning of immune system by supporting the proliferation of Treg cells; a coenzyme to transfer one-carbon units that are necessary for deoxythymidylate synthesis, purine synthesis, and various methylation reactions; maternal folate nutritional status is related to the risk of neural tube defects (ntds) in the offspring; nuritional benefit related to cardiovascular disease, cancer and cognitive functioning; |
| Description : | Folate also known as Vitamin B9 or folic acid is a water soluble vitamin useful in the synthesis of DNA acting as cofactor of enzymes and used as a supplement during pregnancy. It exists mainly in the form of polyglutamate in foods. |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |
| SMILES | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N |
| Formula | C19H19N7O6 |
| InchiKey | OVBPIULPVIDEAO-LBPRGKRZSA-N |
| Kingdom | Organic compounds |
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| LogP | -0.232 |
| Molecular weight | 441.397 |
| Hydrogen Bond Acceptor | 9 |
| Hydrogen Bond Donor | 6 |
| Polar surface area | 209.65 |
| No. of rotatable bonds | 9 |
| Number of Aromatic Rings | 2 |
| Number of rings | 3 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
