| ImmunCR Id : | ICR40 |
| Chemical Name : | Gallocatechin |
| Plant Source : | Punica granatum |
| Nutraceutical information : | Edible, found in: fresh tea leaves and unfermented green tea, pomegrenate. |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | It protects skin from UVB-induced photodamages by improving skin elasticity and collagen fibers, and inhibiting aberrations in mitochondria and formation of melanosomes; free radical scavenging activity; antioxidant effect of GCG due to inhibition of phosphorylation of ERK (extracellular signal-regulated kinase) and JNK (c-Jun N-terminal kinases) leading to suppression of neurocytotoxicity caused by glutamate in HT22 cells, wound healing. |
| Description : | A flavan substituted by hydroxy groups at positions 3, 3', 4', 5, 5' and 7, containing d-glucopyranoside and biflavanol gallocatechin- [4-O-7]-epigallocatechin. |
| IUPAC Name | (2R,3S)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | C1[C@@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)O |
| Formula | C15H14O7 |
| InchiKey | XMOCLSLCDHWDHP-SWLSCSKDSA-N |
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Flavonoids |
| Subclass | Flavans |
| LogP | 1.779 |
| Molecular weight | 306.267 |
| Hydrogen Bond Acceptor | 7 |
| Hydrogen Bond Donor | 6 |
| Polar surface area | 133.823 |
| No. of rotatable bonds | 1 |
| Number of Aromatic Rings | 2 |
| Number of rings | 3 |
| Absorption level | Moderate |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
