| ImmunCR Id : | ICR34 |
| Chemical Name : | Epicatechin |
| Plant Source : | Malus domestica |
| Nutraceutical information : | Edible, Higest content in Cacao dark chocolate, Green Tea, Apple |
| Mode of administration : | Oral, tablets |
| Immunomodulatory mechanism : | Protects cells from oxidative stress, antioxidant. Stimulates mitochondrial respiration and biogenesis, thus interfering with Warburg metabolism. At the cell signaling level, the compound inhibits Erk signaling, which interferes with other signaling pathways including EGFR that are known to be hyperactive in cancer. |
| Description : | A bioactive polyphenolic catechin. |
| IUPAC Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O |
| Formula | C15H14O6 |
| InchiKey | PFTAWBLQPZVEMU-UKRRQHHQSA-N |
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Flavonoids |
| Subclass | Flavans |
| LogP | 2.021 |
| Molecular weight | 290.268 |
| Hydrogen Bond Acceptor | 6 |
| Hydrogen Bond Donor | 5 |
| Polar surface area | 113.007 |
| No. of rotatable bonds | 1 |
| Number of Aromatic Rings | 2 |
| Number of rings | 3 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
