| ImmunCR Id : | ICR31 |
| Chemical Name : | Resveratrol-3-O-β-d-glucopyranoside |
| Plant Source : | Vitis palmata |
| Nutraceutical information : | Edible, found in minor amount in wine, grapes |
| Mode of administration : | Cream |
| Immunomodulatory mechanism : | Anti-inflammatory, immunoregulatory, anti-oxidative and anti-tumor activities. It is shown to mediate a cytotoxic action on colorectal cancer cells by inducing cell arrest and apoptosis, Target Pyruvate kinase PKM |
| Description : | It is a glycoside form of resveratol with a crystalline structure, 3,4,5-Trihydroxystilbene-3-beta-monoglucoside. |
| IUPAC Name | --- |
| SMILES | Oc1ccc(cc1)/C=C/c1cc(cc(O)c1)OC1OC(CO)C(O)C(O)C1O |
| Formula | C20H22O8 |
| InchiKey | HSTZMXCBWJGKHG-OWOJBTEDSA-N |
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Stilbenes |
| Subclass | --- |
| LogP | 1.16 |
| Molecular weight | 390.384 |
| Hydrogen Bond Acceptor | 8 |
| Hydrogen Bond Donor | 6 |
| Polar surface area | --- |
| No. of rotatable bonds | 5 |
| Number of Aromatic Rings | 2 |
| Number of rings | 3 |
| Absorption level | --- |
| Solubility level | --- |
| Blood Brain Barrier | --- |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
