| ImmunCR Id : | ICR29 |
| Chemical Name : | Naringenin |
| Plant Source : | Citrus sps. |
| Nutraceutical information : | Edible, grapefruit, citrus fruits |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Pharmacological effects including antidiabetic, antiatherogenic, antidepressant, immunomodulatory, antitumor, hypolipidemic, antioxidant, and antiinflammatory potentials. Abrogated experimental colitis by down-regulating pro-inflammatory mediators like inos, ICAM-1, monocyte chemoattractant protein-1, COX-2, TNF-α, and IL-6. It also decreased mucosal Toll-like receptor 4 and NF-κb p65 expression, thereby providing evidence for its potential in colitis. Ameliorated DSS-induced colitis by restoring the expression of tight junction proteins such as occludin, junctional adhesion molecule-A, and claudin-3. It inhibits tumor progression by Wnt/β-catenin, PI3K/Akt, NF-ĸb, and TGF-β pathways. |
| Description : | It is a plant flavanone with a chiral carbon at the C2 position and no substitution at the C3 position, differing from flavanoids and used as potent antioxidants |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O |
| Formula | C14H12O3 |
| InchiKey | LUKBXSAWLPMMSZ-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Stilbenes |
| Subclass | --- |
| LogP | 3.09 |
| Molecular weight | 228.243 |
| Hydrogen Bond Acceptor | 3 |
| Hydrogen Bond Donor | 3 |
| Polar surface area | 62.446 |
| No. of rotatable bonds | 2 |
| Number of Aromatic Rings | 2 |
| Number of rings | 2 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Medium |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
