| ImmunCR Id : | ICR25 |
| Chemical Name : | Cannabidiol |
| Plant Source : | Cannabis Sativa |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Analgesic, anticonvulsant, muscle relaxant, anxiolytic, antipsychotic and has shown neuroprotective, anti-inflammatory, and antioxidant activity. Acts on cannabinoid (CB) receptors of the endocannabinoid system, which are found in numerous areas of the body, including the peripheral and central nervous systems, including the brain. |
| Description : | A mild psychoactive compound discovered in 1940, extracted from the Cannabis plant used for pain relief and epileptic seizures. |
| IUPAC Name | 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCC1=CC(=C(C(=C1)O)C2C=C(CCC2C(=C)C)C)O |
| Formula | C21H30O2 |
| InchiKey | QHMBSVQNZZTUGM-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Monoterpenoids |
| LogP | 6.613 |
| Molecular weight | 314.462 |
| Hydrogen Bond Acceptor | 2 |
| Hydrogen Bond Donor | 2 |
| Polar surface area | 41.631 |
| No. of rotatable bonds | 6 |
| Number of Aromatic Rings | 1 |
| Number of rings | 2 |
| Absorption level | Moderate |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Very High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Inhibitor |
