| ImmunCR Id : | ICR24 |
| Chemical Name : | Tetrahydrocannabivarin |
| Plant Source : | Cannabis Sativa |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Acts as a CB1 antagonist and a partial agonist of CB2. Agonist of GPR55 and l-α-lysophosphatidylinositol (LPI). Activate 5HT1A receptors to produce an antipsychotic effect that has therapeutic potential for ameliorating some of the negative, cognitive and positive symptoms of schizophrenia. THCV interacts with different transient receptor potential (TRP) channels including TRPV2, which may contribute to the analgesic, anti-inflammatory and anti-cancer effects of cannabinoids and Cannabis extracts. It has also shown antiepileptiform and anticonvulsant properties, that suggest possible therapeutic application in the treatment of pathophysiologic hyperexcitability states such as untreatable epilepsy. |
| Description : | THCV is a homologue of THC with a propyl side chain, different from 5-carbon side chain of THC giving THCV the ability to produce different effects. |
| IUPAC Name | (6aR,10aR)-6,6,9-trimethyl-3-propyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCC1=CC(=C2C3C=C(CCC3C(OC2=C1)(C)C)C)O |
| Formula | C19H26O2 |
| InchiKey | ZROLHBHDLIHEMS-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Benzopyrans |
| Subclass | 1-benzopyrans |
| LogP | 5.197 |
| Molecular weight | 286.409 |
| Hydrogen Bond Acceptor | 2 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 29.745 |
| No. of rotatable bonds | 2 |
| Number of Aromatic Rings | 1 |
| Number of rings | 3 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Very High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
