| ImmunCR Id : | ICR23 |
| Chemical Name : | Cannabichromene |
| Plant Source : | Cannabis Sativa |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Activates the transient receptor potential ankyrin-type1 and inhibits endocannabinoid inactivation, providing its role in inflammatory pathway. Beneficial effects in experimental colitis by decreasing NO production and ameliorates DNBS-induced colitic inflammation, by improving histology, immunohistochemistry, and myeloperoxidase activity |
| Description : | It is a minor cannabinoid found in cannabis plant with the ability to stimulate brain and nerves. |
| IUPAC Name | 2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromen-5-ol |
| SMILES | CCCCCC1=CC(=C2C=CC(OC2=C1)(C)CCC=C(C)C)O |
| Formula | C21H30O2 |
| InchiKey | UVOLYTDXHDXWJU-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Organoheterocyclic compounds |
| Class | Benzopyrans |
| Subclass | 1-benzopyrans |
| LogP | 6.58 |
| Molecular weight | 314.462 |
| Hydrogen Bond Acceptor | 2 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 29.745 |
| No. of rotatable bonds | 7 |
| Number of Aromatic Rings | 1 |
| Number of rings | 2 |
| Absorption level | Moderate |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Very High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
