| ImmunCR Id : | ICR22 |
| Chemical Name : | Α-Linolenic acid |
| Plant Source : | Brassica napus L. |
| Nutraceutical information : | Edible, Found in oleginous seeds and oils, nuts, walnuts, fish |
| Mode of administration : | Oral, capsules |
| Immunomodulatory mechanism : | Supplementation in diet restored the 8-isoprostanes, GSH levels, and inos expression. Protected against colonic inflammation by reducing TNF-α secretion, NF-κb activation, LTB4, and COX-2 expression, decreased the expression of adhesion molecules like ICAM-1, VCAM-1, and VEGFR-2, providing avenues for designing diets beneficial to IBD |
| Description : | It is an essential polyunsaturated n-3 fatty acid derived mainly from plants , necessary for the synthesis of EPA and DHA |
| IUPAC Name | (9Z,12Z)-octadeca-9,12-dienoic acid |
| SMILES | O=C(O)CCCCCCC\C=C\C\C=C\C\C=C\CC |
| Formula | C18H30O2 |
| InchiKey | DTOSIQBPPRVQHS-IUQGRGSQSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Lineolic acids and derivatives |
| LogP | 5.971 |
| Molecular weight | 278.43 |
| Hydrogen Bond Acceptor | 2 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 38.116 |
| No. of rotatable bonds | 13 |
| Number of Aromatic Rings | 0 |
| Number of rings | 0 |
| Absorption level | Moderate |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Very High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
