| ImmunCR Id : | ICR2 |
| Chemical Name : | Genistein |
| Plant Source : | Glycine max |
| Nutraceutical information : | Edible, Highest content in soy products, chick peas, broad beans. |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | Anti-cancer (inhibit activation of NF-κb and Akt and galls estrogen- and androgen-mediated signaling pathways, inhibit the tyrosine kinase activity, supress AP-1 (activator protein 1), upregulate Bax and Bcl-2 (B cell lymphoma 2), downregulate EGFR (epidermal growth factor receptor), iκb, KIF20A (kinesin-like protein 20A), inhibits PI3K (phosphoinositide 3 kinase), TRAIL (tumor necrosis factor–related apoptosis-inducing ligand), TRAIL R (TRAIL death receptors), Wnt/β-catenin (Wingless and integration 1 β-catenin)); Anti-inflammatory (upregulating MIP-1a, downregulate IL-1β, IL-6, IL-8, TNF-α, NOS, COX-2, suppress TLR-4); Anti-metastasis (inhibit MMP-9, VEGF expression); antioxidant (via AMPK and PTEN pathways, upregulating glutathione, NAD(P)H dehydrogenase) |
| Description : | Genistein, a phytoestrogen is the simplest isoflavonoid belonging to subfamily Papilionoidae and family Leguminosae. Its scientific name is 4′,5,7-trihydroxyisoflavone. It possesses weak estrogenic activity with low solubility in water but highly soluble in polar solvents like ethanol. |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| SMILES | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O |
| Formula | C15H10O5 |
| InchiKey | TZBJGXHYKVUXJN-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Isoflavonoids |
| Subclass | Isoflav-2-enes |
| LogP | 2.14 |
| Molecular weight | 270.237 |
| Hydrogen Bond Acceptor | 5 |
| Hydrogen Bond Donor | 3 |
| Polar surface area | 88.677 |
| No. of rotatable bonds | 1 |
| Number of Aromatic Rings | 2 |
| Number of rings | 3 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Low |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Inhibitor |
