| ImmunCR Id : | ICR16 |
| Chemical Name : | Astragaloside VII |
| Plant Source : | Astragalus oleifolius |
| Nutraceutical information : | --- |
| Mode of administration : | Capsules |
| Immunomodulatory mechanism : | Attenuation of Th1/Th2, Cytokine Imbalance; antigen specific igg, igg1, and igg2b antibody response, production of IL- 2, IFN-γ, TGF-β, IL-17A and enhanced splenocyte proliferation in vitro and in vivo studies; increased IL-1β, IL-2, IFN-γ production, upregulation of both CD86 and CD80, induces dendritic cell maturation and activation in cooperation with LPS (lipopolysaccharide), increase in the expression of CD44 on CD4+ and CD8+ T cells |
| Description : | Astragaloside VII a amphiphilic tridesmosidic glycoside of cycloastragenol is a plant triterpenoid saponin extracted from Astragalus species for use as a vaccine adjuvant, given its high solublility in water with low hemolytic activity and high stability makes it an ideal candidate as an adjuvant |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-14-hydroxy-7,7,12,16-tetramethyl-15-[(2R,5S)-2-methyl-5-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]oxolan-2-yl]-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-9-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol |
| SMILES | CC1C(C(C(C(O1)OC2CC(C34CC35CCC6(C(CCC6(C5C(CC4C2(C)C)O)C)C(C)CCC(C(C)(C)O)OC7C(C(C(CO7)O)O)O)C)O)O)O)O |
| Formula | C41H70O13 |
| InchiKey | JMQANMQRQDNDDA-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Steroids and steroid derivatives |
| Subclass | Steroidal glycosides |
| LogP | 0.995 |
| Molecular weight | 770.987 |
| Hydrogen Bond Acceptor | 13 |
| Hydrogen Bond Donor | 9 |
| Polar surface area | 223.059 |
| No. of rotatable bonds | 9 |
| Number of Aromatic Rings | 0 |
| Number of rings | 7 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
