| ImmunCR Id : | ICR153 |
| Chemical Name : | Zeaxanthin |
| Plant Source : | Green leafy vegetables(kale,spinach, broccoli,peas) and egg yolks |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | --- |
| Description : | Zeaxanthin is a carotenol. It has a role as a bacterial metabolite, a cofactor and an antioxidant. It derives from a hydride of a beta-carotene. |
| IUPAC Name | (1R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C2=C(C[C@H](CC2(C)C)O)C)C)C)/C)/C |
| Formula | C40H56O2 |
| InchiKey | JKQXZKUSFCKOGQ-QAYBQHTQSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Tetraterpenoids |
| LogP | 9.524 |
| Molecular weight | 568.871 |
| Hydrogen Bond Acceptor | 2 |
| Hydrogen Bond Donor | 2 |
| Polar surface area | 41.631 |
| No. of rotatable bonds | 10 |
| Number of Aromatic Rings | 0 |
| Number of rings | 2 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
