| ImmunCR Id : | ICR149 |
| Chemical Name : | Pectin |
| Plant Source : | Beetroot |
| Nutraceutical information : | Nutritional supplement |
| Mode of administration : | Locally, orally, by subcutaneous or intravenous injection, or per rectum. |
| Immunomodulatory mechanism : | Pectin exhibited immunomodulatory activities by increasing the levels of the pro-inflammatory cytokines IL-17, IFN-γ and TNF-α levels |
| Description : | Pectin is a heteropolysaccharide commercially derived from the cell wall of higher plants. It is composed of partially methylated polygalacturonic acid units linked in the positions 1-4. The carboxylic group of the constituents of pectin can exist in the form of esters, free acids, ammonium, potassium or sodium salts or as acid amides. Under the FDA regulation, pectin qualifies as a GRAS (generally recognized as safe) food substance. This status allows pectin to be used with no limitations. |
| IUPAC Name | (2S,3R,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
| SMILES | [C@@H]1([C@H]([C@H](O[C@H]([C@@H]1O)O)C(=O)O)O)O |
| Formula | C6H10O7 |
| InchiKey | AEMOLEFTQBMNLQ-DTEWXJGMSA-N |
| Kingdom | Organic compounds |
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| LogP | -2.386 |
| Molecular weight | 194.139 |
| Hydrogen Bond Acceptor | 7 |
| Hydrogen Bond Donor | 5 |
| Polar surface area | 130.308 |
| No. of rotatable bonds | 1 |
| Number of Aromatic Rings | 0 |
| Number of rings | 1 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
