| ImmunCR Id : | ICR147 |
| Chemical Name : | gamma-Oryzanol |
| Plant Source : | Rice |
| Nutraceutical information : | Nutritional supplements, but it also naturally occurs in wheat, barley, corn, and some vegetables and fruits |
| Mode of administration : | Oral, Tablets |
| Immunomodulatory mechanism : | Immunomodulatory activity |
| Description : | Gamma-Oryzanol (TN) is a triterpenoid. |
| IUPAC Name | [(1S,3R,6S,8R,11S,12S,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methylhept-5-en-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | C[C@H](CCC=C(C)C)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@@H]5[C@]3(C4)CC[C@@H](C5(C)C)OC(=O)/C=C/C6=CC(=C(C=C6)O)OC)C)C |
| Formula | C40H58O4 |
| InchiKey | FODTZLFLDFKIQH-FSVGXZBPSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Steroids and steroid derivatives |
| Subclass | Cycloartanols and derivatives |
| LogP | 9.806 |
| Molecular weight | 602.886 |
| Hydrogen Bond Acceptor | 4 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 55.976 |
| No. of rotatable bonds | 9 |
| Number of Aromatic Rings | 1 |
| Number of rings | 6 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
