| ImmunCR Id : | ICR144 |
| Chemical Name : | D-Pinitol |
| Plant Source : | Plant sources |
| Nutraceutical information : | Used as nutritional supplement for ovarian health and insulin sensitivity |
| Mode of administration : | Capsule |
| Immunomodulatory mechanism : | D-pinitol regulates Th1/Th2 balance via suppressing Th2 immune response in ovalbumin-induced asthma |
| Description : | D-pinitol is the D-enantiomer of pinitol. It has a role as a geroprotector and a member of compatible osmolytes. It is functionally related to a 1D-chiro-inositol. It is an enantiomer of a L-pinitol. |
| IUPAC Name | (1S,2S,4S,5R)-6-methoxycyclohexane-1,2,3,4,5-pentol |
| SMILES | COC1[C@@H]([C@H](C([C@@H]([C@@H]1O)O)O)O)O |
| Formula | C7H14O6 |
| InchiKey | DSCFFEYYQKSRSV-FEPQRWDDSA-N |
| Kingdom | Organic compounds |
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| LogP | -2.656 |
| Molecular weight | 194.182 |
| Hydrogen Bond Acceptor | 6 |
| Hydrogen Bond Donor | 5 |
| Polar surface area | 113.007 |
| No. of rotatable bonds | 1 |
| Number of Aromatic Rings | 0 |
| Number of rings | 1 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
