| ImmunCR Id : | ICR14 |
| Chemical Name : | Peonidin |
| Plant Source : | Prunus cerasus ledeb |
| Nutraceutical information : | Edible, Greatest dietary intake is raw cranberries |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Antioxidant, anti-tumor, reduce oxidative stress, protect against lipid peroxidation, higher effectivity due to presence of 3-O glucoside. |
| Description : | Peonidin is an anthocyanidin cation that is flavylium bearing four hydroxy substituents at positions 3, 4', 5 and 7 as well as a methoxy substituent at position 3'. It is a conjugate acid of a peonidin(1-) . |
| IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)chromenylium-3,5,7-triol |
| SMILES | COC1=C(C=CC(=C1)C2=[O+]C3=CC(=CC(=C3C=C2O)O)O)O |
| Formula | C16H13O6+ |
| InchiKey | XFDQJKDGGOEYPI-UHFFFAOYSA-O |
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Flavonoids |
| Subclass | O-methylated flavonoids |
| LogP | 3.263 |
| Molecular weight | 301.271 |
| Hydrogen Bond Acceptor | 5 |
| Hydrogen Bond Donor | 4 |
| Polar surface area | 104.746 |
| No. of rotatable bonds | 2 |
| Number of Aromatic Rings | 3 |
| Number of rings | 3 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
