| ImmunCR Id : | ICR139 |
| Chemical Name : | beta-Glucan |
| Plant Source : | Cereal grains, particularly oats and barley |
| Nutraceutical information : | Used as a dieatry supplement |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | β-Glucans initiate immune responses via immune cells, which become activated by the binding of the polymer to specific receptors |
| Description : | Beta-Glucan is a polysaccharide isolated from the cell walls of bacteria, plants, and fungi with immunostimulant and antineoplastic activities. In a solubilized form, beta-glucan binds to a lectin site within complement receptor 3 (CR3) on leukocytes, priming the receptor to trigger cytotoxic degranulation of leukocytes when leukocyte CR3 binds to complement 3 (iC3b)-coated tumors. Thus, the attachment of beta-glucan to CR3 of circulating leukocytes simulates leukocytes to kill iC3b-coated tumor cells in the same way as they kill iC3b-coated yeast. (NCI04) |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2R,4R,5R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(2R,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2[C@H](O[C@H]([C@@H]([C@H]2O)O)OC3[C@H](O[C@@H]([C@@H]([C@H]3O)O)O)CO)CO)O)O)O)O |
| Formula | C18H32O16 |
| InchiKey | FYGDTMLNYKFZSV-URKRLVJHSA-N |
| Kingdom | Organic compounds |
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| LogP | -6.008 |
| Molecular weight | 504.437 |
| Hydrogen Bond Acceptor | 16 |
| Hydrogen Bond Donor | 11 |
| Polar surface area | 273.621 |
| No. of rotatable bonds | 7 |
| Number of Aromatic Rings | 0 |
| Number of rings | 3 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
