| ImmunCR Id : | ICR136 |
| Chemical Name : | phenolic acid |
| Plant Source : | Seeds, skins of fruits and leaves of vegetables |
| Nutraceutical information : | Used as a dieatry supplement |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Phenolic acid shows immunomodulatory activity by altering formation of nitric oxide, eicosanoids and inhibiting proinflammatory cytokines and gene expressions |
| Description : | Phenol A acid is a natural product found in Penicillium citrinum with data available. |
| IUPAC Name | 2,6-dihydroxy-4-[(2S,3R)-3-hydroxybutan-2-yl]-3-methylbenzoic acid |
| SMILES | CC1=C(C(=C(C=C1[C@H](C)[C@@H](C)O)O)C(=O)O)O |
| Formula | C12H16O5 |
| InchiKey | UHEOCPAMGZSLMB-IYSWYEEDSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Monoterpenoids |
| LogP | 1.875 |
| Molecular weight | 240.252 |
| Hydrogen Bond Acceptor | 5 |
| Hydrogen Bond Donor | 4 |
| Polar surface area | 100.562 |
| No. of rotatable bonds | 3 |
| Number of Aromatic Rings | 1 |
| Number of rings | 1 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Low |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
