| ImmunCR Id : | ICR134 |
| Chemical Name : | Arachidonic acid |
| Plant Source : | Poultry, animal organs and meat, fish, seafood, and eggs |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | ARA promotes and regulates type 2 immune responses against intestinal and blood flukes and may well represent an invaluable endoschistsomicide and endotumoricide |
| Description : | Arachidonic Acid is an unsaturated, essential fatty acid. It is found in animal and human fat as well as in the liver, brain, and glandular organs, and is a constituent of animal phosphatides. It is formed by the synthesis from dietary linoleic acid and is a precursor in the biosynthesis of prostaglandins, thromboxanes, and leukotrienes.(ChemID Plus) |
| IUPAC Name | (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCC(=O)O |
| Formula | C20H32O2 |
| InchiKey | YZXBAPSDXZZRGB-DOFZRALJSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acids and conjugates |
| LogP | 6.439 |
| Molecular weight | 304.467 |
| Hydrogen Bond Acceptor | 2 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 38.116 |
| No. of rotatable bonds | 14 |
| Number of Aromatic Rings | 0 |
| Number of rings | 0 |
| Absorption level | Moderate |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Very High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
