| ImmunCR Id : | ICR133 |
| Chemical Name : | Linoleic acid |
| Plant Source : | Linum usitatissimum |
| Nutraceutical information : | Edible, Dieatry Supplement |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | Linoleic acid reduces viability and inhibits proliferation in T-cells |
| Description : | Linoleic acid is a colorless to straw colored liquid. A polyunsaturated fatty acid essential to human diet. |
| IUPAC Name | (9Z,12Z)-octadeca-9,12-dienoic acid |
| SMILES | CCCCC/C=CC/C=CCCCCCCCC(=O)O |
| Formula | C18H32O2 |
| InchiKey | OYHQOLUKZRVURQ-HZJYTTRNSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Lineolic acids and derivatives |
| LogP | 6.416 |
| Molecular weight | 280.445 |
| Hydrogen Bond Acceptor | 2 |
| Hydrogen Bond Donor | 1 |
| Polar surface area | 38.116 |
| No. of rotatable bonds | 14 |
| Number of Aromatic Rings | 0 |
| Number of rings | 0 |
| Absorption level | Moderate |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Very High |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
