| ImmunCR Id : | ICR131 |
| Chemical Name : | Hydroxycitric acid |
| Plant Source : | Garcinia cambogia |
| Nutraceutical information : | Used as weight loss supplement |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | HCA decreased the production of NO probably by suppressing the expression of iNOS and TNF-α |
| Description : | Hydroxycitric acid is a carbonyl compound. |
| IUPAC Name | 1,2-dihydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | C(C(=O)O)C(C(C(=O)O)O)(C(=O)O)O |
| Formula | C6H8O8 |
| InchiKey | ZMJBYMUCKBYSCP-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Tricarboxylic acids and derivatives |
| LogP | -1.971 |
| Molecular weight | 208.123 |
| Hydrogen Bond Acceptor | 8 |
| Hydrogen Bond Donor | 5 |
| Polar surface area | 155.979 |
| No. of rotatable bonds | 5 |
| Number of Aromatic Rings | 0 |
| Number of rings | 0 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
