| ImmunCR Id : | ICR130 |
| Chemical Name : | Cuminaldehyde thiosemicarbazone |
| Plant Source : | Cuminum cyminum |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | --- |
| Description : | --- |
| IUPAC Name | [(Z)-(4-propan-2-ylphenyl)methylideneamino]thiourea |
| SMILES | CC(C)C1=CC=C(C=C1)/C=NNC(=S)N |
| Formula | C11H15N3S |
| InchiKey | GCIARVDJUYGSFQ-QPEQYQDCSA-N |
| Kingdom | Organic compounds |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Monoterpenoids |
| LogP | 2.993 |
| Molecular weight | 221.322 |
| Hydrogen Bond Acceptor | 2 |
| Hydrogen Bond Donor | 2 |
| Polar surface area | 50.673 |
| No. of rotatable bonds | 4 |
| Number of Aromatic Rings | 1 |
| Number of rings | 1 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Medium |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
