| ImmunCR Id : | ICR129 |
| Chemical Name : | Chicoric acid |
| Plant Source : | Chicory |
| Nutraceutical information : | --- |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Reduced inflammation was associated with downregulation of nuclear factor jB (NF-jB) and tumornecrosis factor a (TNF-a), |
| Description : | Chicoric acid is an organooxygen compound. It has a role as a HIV-1 integrase inhibitor and a geroprotector. It derives from a tetracarboxylic acid. |
| IUPAC Name | (2R,3R)-2,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]butanedioic acid |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O[C@@H](C(=O)O)[C@@H](OC(=O)/C=C/C2=CC(=C(C=C2)O)O)C(=O)O)O)O |
| Formula | C22H18O12 |
| InchiKey | YDDGKXBLOXEEMN-IABMMNSOSA-N |
| Kingdom | Organic compounds |
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Tetracarboxylic acids and derivatives |
| LogP | 2.39 |
| Molecular weight | 474.371 |
| Hydrogen Bond Acceptor | 12 |
| Hydrogen Bond Donor | 6 |
| Polar surface area | 211.956 |
| No. of rotatable bonds | 11 |
| Number of Aromatic Rings | 2 |
| Number of rings | 2 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
