| ImmunCR Id : | ICR120 |
| Chemical Name : | Aegeline |
| Plant Source : | Aegle marmelos |
| Nutraceutical information : | Edible, Bael |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | Apoptosis (upregulates α-synuclein, Bax, ROS); inhibits CYP3A4 weakly; Anti-diabetic (upregulates GLUT4 translocation, P13K/Rac1/PAK1 signaling pathway); Anti-obesity (downregulates cholestrol, triglycerides, HDL) |
| Description : | Aegeline, N-[2-hydroxy-2-(4-methoxyphenyl) ethyl]-3-phenylprop-2-enamide is an alkaloidal amide of natural origin extracted from Bael plant leaves, which has high therapeutic potential and is used in ayurveda for the treatment of various types of diseases. |
| IUPAC Name | (E)-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-3-phenylprop-2-enamide |
| SMILES | COC1=CC=C(C=C1)C(CNC(=O)/C=C/C2=CC=CC=C2)O |
| Formula | C18H19NO3 |
| InchiKey | QRFDENJATPJOKG-KPKJPENVSA-N |
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Cinnamic acids and derivatives |
| Subclass | Cinnamic acid amides |
| LogP | 2.562 |
| Molecular weight | 297.348 |
| Hydrogen Bond Acceptor | 3 |
| Hydrogen Bond Donor | 2 |
| Polar surface area | 59.856 |
| No. of rotatable bonds | 6 |
| Number of Aromatic Rings | 2 |
| Number of rings | 2 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Medium |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
