| ImmunCR Id : | ICR119 |
| Chemical Name : | Malvidin |
| Plant Source : | Vaccinium myrtillus |
| Nutraceutical information : | Edible, Blueberry, red grapes, (black, blue, purple) barley, Wheat (black, blue, purple) |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | Apoptosis (upregulates Bax, caspase-3, malondialdehyde, caspase-12,-3, GRP78 (glucose-regulated protein 78), CHOP protein, p38 MAPK, ROS generation, ERK, downregulates Bcl-2, SOD, GSH, inhibits STAT3 phosphorylation); Anti-inflammatory (downregulates IL-6, MCP-1, IL-8, TNF-α, iκb-α, inos, inhibits p65 NF-kb ); Antiaging (upregulates SIRT1, SIRT6); Anti-angiogenesis (inhibits VEGF) |
| Description : | Malvidin is the most abundant anthocyanin found in blueberries, along with its 3-glycosylated forms exhibiting multiple therapeutic potentials. It occurs as dark red in matured wines and has high solubility in water because of static dipole moment. |
| IUPAC Name | 2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3,5,7-triol |
| SMILES | COC1=CC(=CC(=C1O)OC)C2=[O+]C3=CC(=CC(=C3C=C2O)O)O |
| Formula | C17H15O7+ |
| InchiKey | KZMACGJDUUWFCH-UHFFFAOYSA-O |
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Flavonoids |
| Subclass | O-methylated flavonoids |
| LogP | 3.247 |
| Molecular weight | 331.297 |
| Hydrogen Bond Acceptor | 6 |
| Hydrogen Bond Donor | 4 |
| Polar surface area | 113.676 |
| No. of rotatable bonds | 3 |
| Number of Aromatic Rings | 3 |
| Number of rings | 3 |
| Absorption level | Good |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Binder |
| CYP2D6 inhibition | Non-Inhibitor |
