| ImmunCR Id : | ICR113 |
| Chemical Name : | Phloridzin |
| Plant Source : | Malus domestica |
| Nutraceutical information : | Edible, Highest content found in dried Mexican oregano, Apple, strawberry, pomegranate juice |
| Mode of administration : | --- |
| Immunomodulatory mechanism : | Anti-diabetic (inhibits Na/glucose cotransporter 1, SGLT1 (sodium glucose cotransporter 1), SGLT2, PTP-MEG2 (megakaryocyte protein kinase phosphatase 2), upregulates phosphorylation of Akt, MAPK); Antioxidant (inhibits ROS, upregulates SOD); Antiaging (upregulates SIRT1); Hepatoprotective (downregulates LDH (lactate dehydrogenase), AST, ALT, TNF-ꭤ, COX-2, nitrite, TBARS (thiobarbituric acid reactive substance), caspase-3, upregulates GSH, TAC (total antioxidant capacity), CAT, GST (glutathione S-transferase), SOD) |
| Description : | Phloridzin, phloretin-2′-β-d-glucopyranoside is a polyphenolic secondary metabolite and is a dihydrochalcone phloretin glucoside with a solid white presence. |
| IUPAC Name | 1-[2,4-dihydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-hydroxyphenyl)propan-1-one |
| SMILES | C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2OC3C(C(C(C(O3)CO)O)O)O)O)O)O |
| Formula | C21H24O10 |
| InchiKey | IOUVKUPGCMBWBT-UHFFFAOYSA-N |
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Flavonoids |
| Subclass | Flavonoid glycosides |
| LogP | 0.827 |
| Molecular weight | 436.409 |
| Hydrogen Bond Acceptor | 10 |
| Hydrogen Bond Donor | 7 |
| Polar surface area | 180.869 |
| No. of rotatable bonds | 7 |
| Number of Aromatic Rings | 2 |
| Number of rings | 3 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
