| ImmunCR Id : | ICR111 |
| Chemical Name : | Cyanidin‑3‑galactoside |
| Plant Source : | Malus domestica |
| Nutraceutical information : | Edible, Apple, blueberry, cranberry, black chokeberry (Aronia melanocarpa) |
| Mode of administration : | Oral |
| Immunomodulatory mechanism : | Anti-diabetic (inhibits α-glucosidase); Anti-inflammatory (downregulates IL-1β, IL-12, IL-6, TNF-α, inos, inhibits p38/JNK/ERK phosphorylation, NF-kb p65); Antioxidant (upregultes SOD, GSH-Px) |
| Description : | Cyanidin-3-galactoside is a water soluble anthocyanin having a hydroxyl group inbibing to its therapeutic potential. |
| IUPAC Name | 2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2OC4C(C(C(C(O4)CO)O)O)O)O)O)O)O |
| Formula | C21H21O11+ |
| InchiKey | RKWHWFONKJEUEF-UHFFFAOYSA-O |
| Kingdom | Organic compounds |
| Superclass | Phenylpropanoids and polyketides |
| Class | Flavonoids |
| Subclass | Flavonoid glycosides |
| LogP | 1.108 |
| Molecular weight | 449.385 |
| Hydrogen Bond Acceptor | 10 |
| Hydrogen Bond Donor | 8 |
| Polar surface area | 196.938 |
| No. of rotatable bonds | 4 |
| Number of Aromatic Rings | 3 |
| Number of rings | 4 |
| Absorption level | Very low |
| Solubility level | Very Soluble |
| Blood Brain Barrier | Undefined |
| Plasma protein binding | Non-Binder |
| CYP2D6 inhibition | Non-Inhibitor |
